C20H22ClN7O4S — CID 141731697
2-[[5-chloro-2-[(5-methylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide (PubChem CID 141731697) has the molecular formula C20H22ClN7O4S and a molecular weight of 492.00 g/mol. Its IUPAC name is 2-[[5-chloro-2-[(5-methylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide.
| Compound Name | 2-[[5-chloro-2-[(5-methylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide |
|---|---|
| PubChem CID | 141731697 |
| Molecular Formula | C20H22ClN7O4S |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 2-[[5-chloro-2-[(5-methylsulfonyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-3-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide |
| SMILES | CONC(=O)C1=CC=CC=C1NC2=CC(=NC=C2Cl)NC3=C4CN(CCN4N=C3)S(=O)(=O)C |
| InChI | InChI=1S/C20H22ClN7O4S/c1-32-26-20(29)13-5-3-4-6-15(13)24-16-9-19(22-10-14(16)21)25-17-11-23-28-8-7-27(12-18(17)28)33(2,30)31/h3-6,9-11H,7-8,12H2,1-2H3,(H,26,29)(H2,22,24,25) |
| InChIKey | WLTLMQPPCYIUDC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | 785 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|