About Gsk-2256098
Gsk-2256098 (PubChem CID 46214930) has the molecular formula C20H23ClN6O2
and a molecular weight of 414.90 g/mol. Its IUPAC name is 2-[[5-chloro-2-[(5-methyl-2-propan-2-ylpyrazol-3-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide.
Molecular Properties
| Compound Name | Gsk-2256098 |
| PubChem CID | 46214930 |
| Molecular Formula | C20H23ClN6O2 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[[5-chloro-2-[(5-methyl-2-propan-2-ylpyrazol-3-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide |
| SMILES | CC1=NN(C(=C1)NC2=NC=C(C(=C2)NC3=CC=CC=C3C(=O)NOC)Cl)C(C)C |
| InChI | InChI=1S/C20H23ClN6O2/c1-12(2)27-19(9-13(3)25-27)24-18-10-17(15(21)11-22-18)23-16-8-6-5-7-14(16)20(28)26-29-4/h5-12H,1-4H3,(H,26,28)(H2,22,23,24) |
| InChIKey | BVAHPPKGOOJSPU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | 539 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze Gsk-2256098 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Gsk-2256098?
The IUPAC name of Gsk-2256098 (CID 46214930) is 2-[[5-chloro-2-[(5-methyl-2-propan-2-ylpyrazol-3-yl)amino]-4-pyridinyl]amino]-N-methoxybenzamide.
What is the SMILES notation for Gsk-2256098?
The canonical SMILES for Gsk-2256098 is CC1=NN(C(=C1)NC2=NC=C(C(=C2)NC3=CC=CC=C3C(=O)NOC)Cl)C(C)C.
What is the InChIKey of Gsk-2256098?
The InChIKey is BVAHPPKGOOJSPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23ClN6O2/c1-12(2)27-19(9-13(3)25-27)24-18-10-17(15(21)11-22-18)23-16-8-6-5-7-14(16)20(28)26-29-4/h5-12H,1-4H3,(H,26,28)(H2,22,23,24).
What are the key properties of Gsk-2256098?
Gsk-2256098 has a molecular weight of 414.90 g/mol, XLogP of 4.50, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Gsk-2256098 is sourced from PubChem (CID 46214930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).