C22H20N4O — CID 1418072
(4S)-6-amino-1,4-diphenyl-3-propyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 1418072) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is (4S)-6-amino-1,4-diphenyl-3-propyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | (4S)-6-amino-1,4-diphenyl-3-propyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 1418072 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (4S)-6-amino-1,4-diphenyl-3-propyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | CCCc1nn(-c2ccccc2)c2c1[C@H](c1ccccc1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C22H20N4O/c1-2-9-18-20-19(15-10-5-3-6-11-15)17(14-23)21(24)27-22(20)26(25-18)16-12-7-4-8-13-16/h3-8,10-13,19H,2,9,24H2,1H3/t19-/m1/s1 |
| InChIKey | QQLWXDZYHUHUMV-LJQANCHMSA-N |
| XLogP | 4.04 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|