C17H16Cl2N4O — CID 4104923
6-amino-4-(2,6-dichlorophenyl)-1-methyl-3-propyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 4104923) has the molecular formula C17H16Cl2N4O and a molecular weight of 363.25 g/mol. Its IUPAC name is 6-amino-4-(2,6-dichlorophenyl)-1-methyl-3-propyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(2,6-dichlorophenyl)-1-methyl-3-propyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 4104923 |
| Molecular Formula | C17H16Cl2N4O |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 6-amino-4-(2,6-dichlorophenyl)-1-methyl-3-propyl-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | CCCc1nn(C)c2c1C(c1c(Cl)cccc1Cl)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C17H16Cl2N4O/c1-3-5-12-15-13(14-10(18)6-4-7-11(14)19)9(8-20)16(21)24-17(15)23(2)22-12/h4,6-7,13H,3,5,21H2,1-2H3 |
| InChIKey | GJNGPPWWXJJHNO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|