C18H16N6O2 — CID 135133157
6-amino-3-ethyl-1-methyl-4-[4-(1,3,4-oxadiazol-2-yl)phenyl]-4H-pyrano[3,2-d]pyrazole-5-carbonitrile (PubChem CID 135133157) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 6-amino-3-ethyl-1-methyl-4-[4-(1,3,4-oxadiazol-2-yl)phenyl]-4H-pyrano[3,2-d]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-3-ethyl-1-methyl-4-[4-(1,3,4-oxadiazol-2-yl)phenyl]-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 135133157 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 6-amino-3-ethyl-1-methyl-4-[4-(1,3,4-oxadiazol-2-yl)phenyl]-4H-pyrano[3,2-d]pyrazole-5-carbonitrile |
| SMILES | CCc1nn(C)c2c1C(c1ccc(-c3nnco3)cc1)C(C#N)=C(N)O2 |
| InChI | InChI=1S/C18H16N6O2/c1-3-13-15-14(12(8-19)16(20)26-18(15)24(2)23-13)10-4-6-11(7-5-10)17-22-21-9-25-17/h4-7,9,14H,3,20H2,1-2H3 |
| InChIKey | TYHQGJAHPFASLX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 115.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_B(9)', 'substructure': 'N/A'} |
|---|