C24H29N3O6 — CID 14181017
2-(4-methoxyphenyl)-N-[2-[3-[2-(methylamino)ethyl]-1H-indol-5-yl]ethyl]acetamide;oxalic acid (PubChem CID 14181017) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[2-[3-[2-(methylamino)ethyl]-1H-indol-5-yl]ethyl]acetamide;oxalic acid.
| Compound Name | 2-(4-methoxyphenyl)-N-[2-[3-[2-(methylamino)ethyl]-1H-indol-5-yl]ethyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 14181017 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[2-[3-[2-(methylamino)ethyl]-1H-indol-5-yl]ethyl]acetamide;oxalic acid |
| SMILES | CNCCc1c[nH]c2ccc(CCNC(=O)Cc3ccc(OC)cc3)cc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H27N3O2.C2H2O4/c1-23-11-10-18-15-25-21-8-5-17(13-20(18)21)9-12-24-22(26)14-16-3-6-19(27-2)7-4-16;3-1(4)2(5)6/h3-8,13,15,23,25H,9-12,14H2,1-2H3,(H,24,26);(H,3,4)(H,5,6) |
| InChIKey | HDNBMLLRSCAQOE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 140.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|