C17H21NO6 — CID 14182217
methyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate;oxalic acid (PubChem CID 14182217) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is methyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate;oxalic acid.
| Compound Name | methyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 14182217 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | methyl 1-ethyl-4-phenyl-3,6-dihydro-2H-pyridine-5-carboxylate;oxalic acid |
| SMILES | CCN1CCC(c2ccccc2)=C(C(=O)OC)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H19NO2.C2H2O4/c1-3-16-10-9-13(12-7-5-4-6-8-12)14(11-16)15(17)18-2;3-1(4)2(5)6/h4-8H,3,9-11H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | LQHWLESHMQULFK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|