C13H18O6 — CID 14185485
[(3aS,4S,7S,7aS)-7-acetyloxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate (PubChem CID 14185485) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is [(3aS,4S,7S,7aS)-7-acetyloxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate.
| Compound Name | [(3aS,4S,7S,7aS)-7-acetyloxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 14185485 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | [(3aS,4S,7S,7aS)-7-acetyloxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzodioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@H](OC(C)=O)[C@@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C13H18O6/c1-7(14)16-9-5-6-10(17-8(2)15)12-11(9)18-13(3,4)19-12/h5-6,9-12H,1-4H3/t9-,10-,11-,12-/m0/s1 |
| InChIKey | BWJDYPUWDGBXQB-BJDJZHNGSA-N |
| XLogP | 0.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|