C22H26N2O3 — CID 14186452
4-[(3-amino-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoic acid (PubChem CID 14186452) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[(3-amino-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoic acid.
| Compound Name | 4-[(3-amino-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 14186452 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-[(3-amino-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)carbamoyl]benzoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(NC(=O)c3ccc(C(=O)O)cc3)c(N)cc21 |
| InChI | InChI=1S/C22H26N2O3/c1-21(2)9-10-22(3,4)16-12-18(17(23)11-15(16)21)24-19(25)13-5-7-14(8-6-13)20(26)27/h5-8,11-12H,9-10,23H2,1-4H3,(H,24,25)(H,26,27) |
| InChIKey | CZVYHWYKUBXKMN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|