C22H28O4S2 — CID 14188348
(3S)-3-(2-methoxyethoxymethoxy)-1,1-bis[(4-methylphenyl)sulfanyl]butan-2-one (PubChem CID 14188348) has the molecular formula C22H28O4S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is (3S)-3-(2-methoxyethoxymethoxy)-1,1-bis[(4-methylphenyl)sulfanyl]butan-2-one.
| Compound Name | (3S)-3-(2-methoxyethoxymethoxy)-1,1-bis[(4-methylphenyl)sulfanyl]butan-2-one |
|---|---|
| PubChem CID | 14188348 |
| Molecular Formula | C22H28O4S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (3S)-3-(2-methoxyethoxymethoxy)-1,1-bis[(4-methylphenyl)sulfanyl]butan-2-one |
| SMILES | COCCOCO[C@@H](C)C(=O)C(Sc1ccc(C)cc1)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C22H28O4S2/c1-16-5-9-19(10-6-16)27-22(28-20-11-7-17(2)8-12-20)21(23)18(3)26-15-25-14-13-24-4/h5-12,18,22H,13-15H2,1-4H3/t18-/m0/s1 |
| InChIKey | NPYJDMIFLHFVNX-SFHVURJKSA-N |
| XLogP | 5.11 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|