C21H26O2S2 — CID 14188367
(4S,5S)-4-[bis[(4-methylphenyl)sulfanyl]methyl]-2,2,5-trimethyl-1,3-dioxolane (PubChem CID 14188367) has the molecular formula C21H26O2S2 and a molecular weight of 374.57 g/mol. Its IUPAC name is (4S,5S)-4-[bis[(4-methylphenyl)sulfanyl]methyl]-2,2,5-trimethyl-1,3-dioxolane.
| Compound Name | (4S,5S)-4-[bis[(4-methylphenyl)sulfanyl]methyl]-2,2,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 14188367 |
| Molecular Formula | C21H26O2S2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (4S,5S)-4-[bis[(4-methylphenyl)sulfanyl]methyl]-2,2,5-trimethyl-1,3-dioxolane |
| SMILES | Cc1ccc(SC(Sc2ccc(C)cc2)[C@H]2OC(C)(C)O[C@H]2C)cc1 |
| InChI | InChI=1S/C21H26O2S2/c1-14-6-10-17(11-7-14)24-20(19-16(3)22-21(4,5)23-19)25-18-12-8-15(2)9-13-18/h6-13,16,19-20H,1-5H3/t16-,19-/m0/s1 |
| InChIKey | VUKCDPWWZPCSEO-LPHOPBHVSA-N |
| XLogP | 6.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|