C21H44O — CID 14195680
5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol (PubChem CID 14195680) has the molecular formula C21H44O and a molecular weight of 312.58 g/mol. Its IUPAC name is 5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol.
| Compound Name | 5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol |
|---|---|
| PubChem CID | 14195680 |
| Molecular Formula | C21H44O |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 312.34 |
| IUPAC Name | 5-butyl-5-ethyl-2,2-dimethyltridecan-3-ol |
| SMILES | CCCCCCCCC(CC)(CCCC)CC(O)C(C)(C)C |
| InChI | InChI=1S/C21H44O/c1-7-10-12-13-14-15-17-21(9-3,16-11-8-2)18-19(22)20(4,5)6/h19,22H,7-18H2,1-6H3 |
| InChIKey | WGLXEHWNDFRHBO-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|