C21H44O2 — CID 19375238
4-butyl-4-hexyl-2,2,6,6-tetramethylheptane-3,5-diol (PubChem CID 19375238) has the molecular formula C21H44O2 and a molecular weight of 328.58 g/mol. Its IUPAC name is 4-butyl-4-hexyl-2,2,6,6-tetramethylheptane-3,5-diol.
| Compound Name | 4-butyl-4-hexyl-2,2,6,6-tetramethylheptane-3,5-diol |
|---|---|
| PubChem CID | 19375238 |
| Molecular Formula | C21H44O2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.33 |
| IUPAC Name | 4-butyl-4-hexyl-2,2,6,6-tetramethylheptane-3,5-diol |
| SMILES | CCCCCCC(CCCC)(C(O)C(C)(C)C)C(O)C(C)(C)C |
| InChI | InChI=1S/C21H44O2/c1-9-11-13-14-16-21(15-12-10-2,17(22)19(3,4)5)18(23)20(6,7)8/h17-18,22-23H,9-16H2,1-8H3 |
| InChIKey | LPFUFQDWZJMNHO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|