C10H11N3O — CID 14199524
5-(2-phenylethyl)-1,3,4-oxadiazol-2-amine (PubChem CID 14199524) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 5-(2-phenylethyl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-phenylethyl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 14199524 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 5-(2-phenylethyl)-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(CCc2ccccc2)o1 |
| InChI | InChI=1S/C10H11N3O/c11-10-13-12-9(14-10)7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,11,13) |
| InChIKey | HOUJXRMAYWZMHT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |