C12H21N — CID 142000853
3-[(Z,2Z)-2-ethylidenepent-3-enyl]piperidine (PubChem CID 142000853) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 3-[(Z,2Z)-2-ethylidenepent-3-enyl]piperidine.
| Compound Name | 3-[(Z,2Z)-2-ethylidenepent-3-enyl]piperidine |
|---|---|
| PubChem CID | 142000853 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 3-[(Z,2Z)-2-ethylidenepent-3-enyl]piperidine |
| SMILES | C/C=C\C(=C/C)CC1CCCNC1 |
| InChI | InChI=1S/C12H21N/c1-3-6-11(4-2)9-12-7-5-8-13-10-12/h3-4,6,12-13H,5,7-10H2,1-2H3/b6-3-,11-4+ |
| InChIKey | ZHTUCRZNIQPNLA-WVVGTSEZSA-N |
| XLogP | 2.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|