C13H21N — CID 143938977
3-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]piperidine (PubChem CID 143938977) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 3-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]piperidine.
| Compound Name | 3-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]piperidine |
|---|---|
| PubChem CID | 143938977 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 3-[(2Z,4Z)-4-methylhepta-2,4,6-trienyl]piperidine |
| SMILES | C=C/C=C(C)\C=C/CC1CCCNC1 |
| InChI | InChI=1S/C13H21N/c1-3-6-12(2)7-4-8-13-9-5-10-14-11-13/h3-4,6-7,13-14H,1,5,8-11H2,2H3/b7-4-,12-6- |
| InChIKey | RDHWKJMZOALBAJ-WDWCXKIISA-N |
| XLogP | 3.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|