C21H33NO — CID 142000888
3-[4-(cyclohexa-1,3-dien-1-ylmethyl)piperidin-1-yl]-1-(cyclohexen-1-yl)propan-1-ol (PubChem CID 142000888) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is 3-[4-(cyclohexa-1,3-dien-1-ylmethyl)piperidin-1-yl]-1-(cyclohexen-1-yl)propan-1-ol.
| Compound Name | 3-[4-(cyclohexa-1,3-dien-1-ylmethyl)piperidin-1-yl]-1-(cyclohexen-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 142000888 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | 3-[4-(cyclohexa-1,3-dien-1-ylmethyl)piperidin-1-yl]-1-(cyclohexen-1-yl)propan-1-ol |
| SMILES | OC(CCN1CCC(CC2=CC=CCC2)CC1)C1=CCCCC1 |
| InChI | InChI=1S/C21H33NO/c23-21(20-9-5-2-6-10-20)13-16-22-14-11-19(12-15-22)17-18-7-3-1-4-8-18/h1,3,7,9,19,21,23H,2,4-6,8,10-17H2 |
| InChIKey | AROCHJHOGDWYSF-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|