C24H39NO2 — CID 123280097
1-[4-[(1-cyclobutylpiperidin-4-ylidene)methyl]cyclohexa-1,5-dien-1-yl]-4-propylpentane-1,5-diol (PubChem CID 123280097) has the molecular formula C24H39NO2 and a molecular weight of 373.58 g/mol. Its IUPAC name is 1-[4-[(1-cyclobutylpiperidin-4-ylidene)methyl]cyclohexa-1,5-dien-1-yl]-4-propylpentane-1,5-diol.
| Compound Name | 1-[4-[(1-cyclobutylpiperidin-4-ylidene)methyl]cyclohexa-1,5-dien-1-yl]-4-propylpentane-1,5-diol |
|---|---|
| PubChem CID | 123280097 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | 1-[4-[(1-cyclobutylpiperidin-4-ylidene)methyl]cyclohexa-1,5-dien-1-yl]-4-propylpentane-1,5-diol |
| SMILES | CCCC(CO)CCC(O)C1=CCC(C=C2CCN(C3CCC3)CC2)C=C1 |
| InChI | InChI=1S/C24H39NO2/c1-2-4-21(18-26)9-12-24(27)22-10-7-19(8-11-22)17-20-13-15-25(16-14-20)23-5-3-6-23/h7,10-11,17,19,21,23-24,26-27H,2-6,8-9,12-16,18H2,1H3 |
| InChIKey | IBAWOAQSMPPTJE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|