C17H23N3O — CID 142002586
[benzyl(3-imidazol-1-ylpropyl)amino]methanol;prop-1-yne (PubChem CID 142002586) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is [benzyl(3-imidazol-1-ylpropyl)amino]methanol;prop-1-yne.
| Compound Name | [benzyl(3-imidazol-1-ylpropyl)amino]methanol;prop-1-yne |
|---|---|
| PubChem CID | 142002586 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | [benzyl(3-imidazol-1-ylpropyl)amino]methanol;prop-1-yne |
| SMILES | C#CC.OCN(CCCn1ccnc1)Cc1ccccc1 |
| InChI | InChI=1S/C14H19N3O.C3H4/c18-13-17(11-14-5-2-1-3-6-14)9-4-8-16-10-7-15-12-16;1-3-2/h1-3,5-7,10,12,18H,4,8-9,11,13H2;1H,2H3 |
| InChIKey | UFFGXPAFWMSOAD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|