C18H24N2O3 — CID 142003627
2-amino-4-methylpentanoic acid;(4-methanimidoylnaphthalen-1-yl)methanol (PubChem CID 142003627) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;(4-methanimidoylnaphthalen-1-yl)methanol.
| Compound Name | 2-amino-4-methylpentanoic acid;(4-methanimidoylnaphthalen-1-yl)methanol |
|---|---|
| PubChem CID | 142003627 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;(4-methanimidoylnaphthalen-1-yl)methanol |
| SMILES | CC(C)CC(N)C(=O)O.[H]/N=C/c1ccc(CO)c2ccccc12 |
| InChI | InChI=1S/C12H11NO.C6H13NO2/c13-7-9-5-6-10(8-14)12-4-2-1-3-11(9)12;1-4(2)3-5(7)6(8)9/h1-7,13-14H,8H2;4-5H,3,7H2,1-2H3,(H,8,9)/b13-7+; |
| InChIKey | AQBDESZWAGFSJU-FTPOTTDRSA-N |
| XLogP | 2.77 |
| TPSA | 107.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|