About 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane
1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane (PubChem CID 142004668) has the molecular formula C17H26N4O2S
and a molecular weight of 350.49 g/mol. Its IUPAC name is 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane.
Molecular Properties
| Compound Name | 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane |
| PubChem CID | 142004668 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane |
| SMILES | CCCC.N#Cc1ccc(CNC(=O)C2CCCN2C(=O)CN)s1 |
| InChI | InChI=1S/C13H16N4O2S.C4H10/c14-6-9-3-4-10(20-9)8-16-13(19)11-2-1-5-17(11)12(18)7-15;1-3-4-2/h3-4,11H,1-2,5,7-8,15H2,(H,16,19);3-4H2,1-2H3 |
| InChIKey | IUDVSAJOLZGHAK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane?
The IUPAC name of 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane (CID 142004668) is 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane.
What is the SMILES notation for 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane?
The canonical SMILES for 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane is CCCC.N#Cc1ccc(CNC(=O)C2CCCN2C(=O)CN)s1.
What is the InChIKey of 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane?
The InChIKey is IUDVSAJOLZGHAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O2S.C4H10/c14-6-9-3-4-10(20-9)8-16-13(19)11-2-1-5-17(11)12(18)7-15;1-3-4-2/h3-4,11H,1-2,5,7-8,15H2,(H,16,19);3-4H2,1-2H3.
What are the key properties of 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane?
1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane has a molecular weight of 350.49 g/mol, XLogP of 1.99, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane is sourced from PubChem (CID 142004668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).