C17H26N4O2S — CID 142004668
1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane (PubChem CID 142004668) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane.
| Compound Name | 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane |
|---|---|
| PubChem CID | 142004668 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-(2-aminoacetyl)-N-[(5-cyanothiophen-2-yl)methyl]pyrrolidine-2-carboxamide;butane |
| SMILES | CCCC.N#Cc1ccc(CNC(=O)C2CCCN2C(=O)CN)s1 |
| InChI | InChI=1S/C13H16N4O2S.C4H10/c14-6-9-3-4-10(20-9)8-16-13(19)11-2-1-5-17(11)12(18)7-15;1-3-4-2/h3-4,11H,1-2,5,7-8,15H2,(H,16,19);3-4H2,1-2H3 |
| InChIKey | IUDVSAJOLZGHAK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |