C17H30N6O2S — CID 142004694
1-(2-aminoacetyl)-N-[[5-[(Z)-C-aminocarbonohydrazonoyl]thiophen-2-yl]methyl]pyrrolidine-2-carboxamide;butane (PubChem CID 142004694) has the molecular formula C17H30N6O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-(2-aminoacetyl)-N-[[5-[(Z)-C-aminocarbonohydrazonoyl]thiophen-2-yl]methyl]pyrrolidine-2-carboxamide;butane.
| Compound Name | 1-(2-aminoacetyl)-N-[[5-[(Z)-C-aminocarbonohydrazonoyl]thiophen-2-yl]methyl]pyrrolidine-2-carboxamide;butane |
|---|---|
| PubChem CID | 142004694 |
| Molecular Formula | C17H30N6O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-(2-aminoacetyl)-N-[[5-[(Z)-C-aminocarbonohydrazonoyl]thiophen-2-yl]methyl]pyrrolidine-2-carboxamide;butane |
| SMILES | CCCC.NCC(=O)N1CCCC1C(=O)NCc1ccc(/C(N)=N/N)s1 |
| InChI | InChI=1S/C13H20N6O2S.C4H10/c14-6-11(20)19-5-1-2-9(19)13(21)17-7-8-3-4-10(22-8)12(15)18-16;1-3-4-2/h3-4,9H,1-2,5-7,14,16H2,(H2,15,18)(H,17,21);3-4H2,1-2H3 |
| InChIKey | HOVDDUUKWMRGHC-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|