C28H33N5O2S — CID 18337714
N-[(5-carbamimidoylthiophen-2-yl)methyl]-1-[2-(ethylamino)-3,3-diphenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 18337714) has the molecular formula C28H33N5O2S and a molecular weight of 503.67 g/mol. Its IUPAC name is N-[(5-carbamimidoylthiophen-2-yl)methyl]-1-[2-(ethylamino)-3,3-diphenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(5-carbamimidoylthiophen-2-yl)methyl]-1-[2-(ethylamino)-3,3-diphenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 18337714 |
| Molecular Formula | C28H33N5O2S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | N-[(5-carbamimidoylthiophen-2-yl)methyl]-1-[2-(ethylamino)-3,3-diphenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2CCCN2C(=O)C(NCC)C(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C28H33N5O2S/c1-2-31-25(24(19-10-5-3-6-11-19)20-12-7-4-8-13-20)28(35)33-17-9-14-22(33)27(34)32-18-21-15-16-23(36-21)26(29)30/h3-8,10-13,15-16,22,24-25,31H,2,9,14,17-18H2,1H3,(H3,29,30)(H,32,34) |
| InChIKey | ZQPRGPPCXNSQGO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|