C32H39N5O4S — CID 18337730
tert-butyl 2-[[1-[2-[(5-carbamimidoylthiophen-2-yl)methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]acetate (PubChem CID 18337730) has the molecular formula C32H39N5O4S and a molecular weight of 589.76 g/mol. Its IUPAC name is tert-butyl 2-[[1-[2-[(5-carbamimidoylthiophen-2-yl)methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]acetate.
| Compound Name | tert-butyl 2-[[1-[2-[(5-carbamimidoylthiophen-2-yl)methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 18337730 |
| Molecular Formula | C32H39N5O4S |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | tert-butyl 2-[[1-[2-[(5-carbamimidoylthiophen-2-yl)methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]acetate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2CCCN2C(=O)C(NCC(=O)OC(C)(C)C)C(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C32H39N5O4S/c1-32(2,3)41-26(38)20-35-28(27(21-11-6-4-7-12-21)22-13-8-5-9-14-22)31(40)37-18-10-15-24(37)30(39)36-19-23-16-17-25(42-23)29(33)34/h4-9,11-14,16-17,24,27-28,35H,10,15,18-20H2,1-3H3,(H3,33,34)(H,36,39) |
| InChIKey | SEBWLWGALCURRF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 137.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|