C29H33N5O4S — CID 59923509
3-[[(2R)-1-[2-[(5-carbamimidoylthiophen-2-yl)methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]propanoic acid (PubChem CID 59923509) has the molecular formula C29H33N5O4S and a molecular weight of 547.68 g/mol. Its IUPAC name is 3-[[(2R)-1-[2-[(5-carbamimidoylthiophen-2-yl)methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]propanoic acid.
| Compound Name | 3-[[(2R)-1-[2-[(5-carbamimidoylthiophen-2-yl)methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 59923509 |
| Molecular Formula | C29H33N5O4S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | 3-[[(2R)-1-[2-[(5-carbamimidoylthiophen-2-yl)methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2CCCN2C(=O)[C@H](NCCC(=O)O)C(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C29H33N5O4S/c30-27(31)23-14-13-21(39-23)18-33-28(37)22-12-7-17-34(22)29(38)26(32-16-15-24(35)36)25(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-6,8-11,13-14,22,25-26,32H,7,12,15-18H2,(H3,30,31)(H,33,37)(H,35,36)/t22?,26-/m1/s1 |
| InChIKey | OJURMMJZOIFSGO-ZWAGFTRDSA-N |
| XLogP | 2.90 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|