C35H43N5O6S — CID 10349420
[(Z)-[amino-[5-[[[(2S)-1-[(2R)-2-[(2-ethoxy-2-oxoethyl)amino]-3,3-diphenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]thiophen-2-yl]methylidene]amino] 2,2-dimethylpropanoate (PubChem CID 10349420) has the molecular formula C35H43N5O6S and a molecular weight of 661.83 g/mol. Its IUPAC name is [(Z)-[amino-[5-[[[(2S)-1-[(2R)-2-[(2-ethoxy-2-oxoethyl)amino]-3,3-diphenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]thiophen-2-yl]methylidene]amino] 2,2-dimethylpropanoate.
| Compound Name | [(Z)-[amino-[5-[[[(2S)-1-[(2R)-2-[(2-ethoxy-2-oxoethyl)amino]-3,3-diphenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]thiophen-2-yl]methylidene]amino] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10349420 |
| Molecular Formula | C35H43N5O6S |
| Molecular Weight | 661.83 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | [(Z)-[amino-[5-[[[(2S)-1-[(2R)-2-[(2-ethoxy-2-oxoethyl)amino]-3,3-diphenylpropanoyl]pyrrolidine-2-carbonyl]amino]methyl]thiophen-2-yl]methylidene]amino] 2,2-dimethylpropanoate |
| SMILES | CCOC(=O)CN[C@@H](C(=O)N1CCC[C@H]1C(=O)NCc1ccc(/C(N)=N/OC(=O)C(C)(C)C)s1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H43N5O6S/c1-5-45-28(41)22-37-30(29(23-13-8-6-9-14-23)24-15-10-7-11-16-24)33(43)40-20-12-17-26(40)32(42)38-21-25-18-19-27(47-25)31(36)39-46-34(44)35(2,3)4/h6-11,13-16,18-19,26,29-30,37H,5,12,17,20-22H2,1-4H3,(H2,36,39)(H,38,42)/t26-,30+/m0/s1 |
| InChIKey | HKQRYEWROXPMEB-FREGXXQWSA-N |
| XLogP | 3.92 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.83 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|