C32H39N5O5S — CID 11061078
tert-butyl 2-[[(2R)-1-[(2S)-2-[[5-[(E)-N'-hydroxycarbamimidoyl]thiophen-3-yl]methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]acetate (PubChem CID 11061078) has the molecular formula C32H39N5O5S and a molecular weight of 605.76 g/mol. Its IUPAC name is tert-butyl 2-[[(2R)-1-[(2S)-2-[[5-[(E)-N'-hydroxycarbamimidoyl]thiophen-3-yl]methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]acetate.
| Compound Name | tert-butyl 2-[[(2R)-1-[(2S)-2-[[5-[(E)-N'-hydroxycarbamimidoyl]thiophen-3-yl]methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 11061078 |
| Molecular Formula | C32H39N5O5S |
| Molecular Weight | 605.76 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | tert-butyl 2-[[(2R)-1-[(2S)-2-[[5-[(E)-N'-hydroxycarbamimidoyl]thiophen-3-yl]methylcarbamoyl]pyrrolidin-1-yl]-1-oxo-3,3-diphenylpropan-2-yl]amino]acetate |
| SMILES | CC(C)(C)OC(=O)CN[C@@H](C(=O)N1CCC[C@H]1C(=O)NCc1csc(/C(N)=N\O)c1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H39N5O5S/c1-32(2,3)42-26(38)19-34-28(27(22-11-6-4-7-12-22)23-13-8-5-9-14-23)31(40)37-16-10-15-24(37)30(39)35-18-21-17-25(43-20-21)29(33)36-41/h4-9,11-14,17,20,24,27-28,34,41H,10,15-16,18-19H2,1-3H3,(H2,33,36)(H,35,39)/t24-,28+/m0/s1 |
| InChIKey | KIXBSLKJQUVZQS-RBJSKKJNSA-N |
| XLogP | 3.58 |
| TPSA | 146.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|