C26H34N6O5S — CID 146029939
(2S)-N-[3-(diaminomethylideneamino)-3-oxopropyl]-1-[(2R)-2-(ethylsulfonylamino)-3,3-diphenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 146029939) has the molecular formula C26H34N6O5S and a molecular weight of 542.66 g/mol. Its IUPAC name is (2S)-N-[3-(diaminomethylideneamino)-3-oxopropyl]-1-[(2R)-2-(ethylsulfonylamino)-3,3-diphenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-(diaminomethylideneamino)-3-oxopropyl]-1-[(2R)-2-(ethylsulfonylamino)-3,3-diphenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146029939 |
| Molecular Formula | C26H34N6O5S |
| Molecular Weight | 542.66 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | (2S)-N-[3-(diaminomethylideneamino)-3-oxopropyl]-1-[(2R)-2-(ethylsulfonylamino)-3,3-diphenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CCS(=O)(=O)N[C@@H](C(=O)N1CCC[C@H]1C(=O)NCCC(=O)N=C(N)N)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34N6O5S/c1-2-38(36,37)31-23(22(18-10-5-3-6-11-18)19-12-7-4-8-13-19)25(35)32-17-9-14-20(32)24(34)29-16-15-21(33)30-26(27)28/h3-8,10-13,20,22-23,31H,2,9,14-17H2,1H3,(H,29,34)(H4,27,28,30,33)/t20-,23+/m0/s1 |
| InChIKey | KJKVUJWLFSMHDY-NZQKXSOJSA-N |
| XLogP | 0.42 |
| TPSA | 177.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.66 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|