C27H35N3O6S — CID 142641995
methyl 4-[[(2S)-1-[(2R)-2-(methanesulfonamido)-3,3-diphenylpropanoyl]piperidine-2-carbonyl]amino]butanoate (PubChem CID 142641995) has the molecular formula C27H35N3O6S and a molecular weight of 529.66 g/mol. Its IUPAC name is methyl 4-[[(2S)-1-[(2R)-2-(methanesulfonamido)-3,3-diphenylpropanoyl]piperidine-2-carbonyl]amino]butanoate.
| Compound Name | methyl 4-[[(2S)-1-[(2R)-2-(methanesulfonamido)-3,3-diphenylpropanoyl]piperidine-2-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 142641995 |
| Molecular Formula | C27H35N3O6S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | methyl 4-[[(2S)-1-[(2R)-2-(methanesulfonamido)-3,3-diphenylpropanoyl]piperidine-2-carbonyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)[C@@H]1CCCCN1C(=O)[C@H](NS(C)(=O)=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H35N3O6S/c1-36-23(31)17-11-18-28-26(32)22-16-9-10-19-30(22)27(33)25(29-37(2,34)35)24(20-12-5-3-6-13-20)21-14-7-4-8-15-21/h3-8,12-15,22,24-25,29H,9-11,16-19H2,1-2H3,(H,28,32)/t22-,25+/m0/s1 |
| InChIKey | OIYRHYGOUKMUGG-WIOPSUGQSA-N |
| XLogP | 2.19 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|