C28H31FN6O4S — CID 23516813
N-[(4-carbamimidoyl-3-fluorophenyl)methyl]-1-[3,3-diphenyl-2-(sulfamoylamino)propanoyl]pyrrolidine-2-carboxamide (PubChem CID 23516813) has the molecular formula C28H31FN6O4S and a molecular weight of 566.66 g/mol. Its IUPAC name is N-[(4-carbamimidoyl-3-fluorophenyl)methyl]-1-[3,3-diphenyl-2-(sulfamoylamino)propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(4-carbamimidoyl-3-fluorophenyl)methyl]-1-[3,3-diphenyl-2-(sulfamoylamino)propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23516813 |
| Molecular Formula | C28H31FN6O4S |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | N-[(4-carbamimidoyl-3-fluorophenyl)methyl]-1-[3,3-diphenyl-2-(sulfamoylamino)propanoyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2CCCN2C(=O)C(NS(N)(=O)=O)C(c2ccccc2)c2ccccc2)cc1F |
| InChI | InChI=1S/C28H31FN6O4S/c29-22-16-18(13-14-21(22)26(30)31)17-33-27(36)23-12-7-15-35(23)28(37)25(34-40(32,38)39)24(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-6,8-11,13-14,16,23-25,34H,7,12,15,17H2,(H3,30,31)(H,33,36)(H2,32,38,39) |
| InChIKey | JVAXCCKVAHSDLC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 171.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|