C24H37N5O5S — CID 135718553
N-[(4-carbamimidoyl-3-hydroxyphenyl)methyl]-1-[3-cyclohexyl-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxamide (PubChem CID 135718553) has the molecular formula C24H37N5O5S and a molecular weight of 507.66 g/mol. Its IUPAC name is N-[(4-carbamimidoyl-3-hydroxyphenyl)methyl]-1-[3-cyclohexyl-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(4-carbamimidoyl-3-hydroxyphenyl)methyl]-1-[3-cyclohexyl-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135718553 |
| Molecular Formula | C24H37N5O5S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | N-[(4-carbamimidoyl-3-hydroxyphenyl)methyl]-1-[3-cyclohexyl-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2CCCN2C(=O)C(CC2CCCCC2)NS(=O)(=O)CC)cc1O |
| InChI | InChI=1S/C24H37N5O5S/c1-2-35(33,34)28-19(13-16-7-4-3-5-8-16)24(32)29-12-6-9-20(29)23(31)27-15-17-10-11-18(22(25)26)21(30)14-17/h10-11,14,16,19-20,28,30H,2-9,12-13,15H2,1H3,(H3,25,26)(H,27,31) |
| InChIKey | CAAQVHQCVZJZAF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 165.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|