C22H31N5O5 — CID 175130346
[(1R)-2-[(2S)-2-[(4-carbamimidoyl-3-hydroxyphenyl)methylcarbamoyl]azetidin-1-yl]-1-cyclohexyl-2-oxoethyl] 2-aminoacetate (PubChem CID 175130346) has the molecular formula C22H31N5O5 and a molecular weight of 445.52 g/mol. Its IUPAC name is [(1R)-2-[(2S)-2-[(4-carbamimidoyl-3-hydroxyphenyl)methylcarbamoyl]azetidin-1-yl]-1-cyclohexyl-2-oxoethyl] 2-aminoacetate.
| Compound Name | [(1R)-2-[(2S)-2-[(4-carbamimidoyl-3-hydroxyphenyl)methylcarbamoyl]azetidin-1-yl]-1-cyclohexyl-2-oxoethyl] 2-aminoacetate |
|---|---|
| PubChem CID | 175130346 |
| Molecular Formula | C22H31N5O5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | [(1R)-2-[(2S)-2-[(4-carbamimidoyl-3-hydroxyphenyl)methylcarbamoyl]azetidin-1-yl]-1-cyclohexyl-2-oxoethyl] 2-aminoacetate |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H]2CCN2C(=O)[C@H](OC(=O)CN)C2CCCCC2)cc1O |
| InChI | InChI=1S/C22H31N5O5/c23-11-18(29)32-19(14-4-2-1-3-5-14)22(31)27-9-8-16(27)21(30)26-12-13-6-7-15(20(24)25)17(28)10-13/h6-7,10,14,16,19,28H,1-5,8-9,11-12,23H2,(H3,24,25)(H,26,30)/t16-,19+/m0/s1 |
| InChIKey | IGUBOBMWBFMXDS-QFBILLFUSA-N |
| XLogP | 0.34 |
| TPSA | 171.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|