C24H34F3N5O5S — CID 135718548
N-[(4-carbamimidoyl-2,3,6-trifluoro-5-hydroxyphenyl)methyl]-1-[3-cyclohexyl-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxamide (PubChem CID 135718548) has the molecular formula C24H34F3N5O5S and a molecular weight of 561.63 g/mol. Its IUPAC name is N-[(4-carbamimidoyl-2,3,6-trifluoro-5-hydroxyphenyl)methyl]-1-[3-cyclohexyl-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(4-carbamimidoyl-2,3,6-trifluoro-5-hydroxyphenyl)methyl]-1-[3-cyclohexyl-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 135718548 |
| Molecular Formula | C24H34F3N5O5S |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | N-[(4-carbamimidoyl-2,3,6-trifluoro-5-hydroxyphenyl)methyl]-1-[3-cyclohexyl-2-(ethylsulfonylamino)propanoyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1c(O)c(F)c(CNC(=O)C2CCCN2C(=O)C(CC2CCCCC2)NS(=O)(=O)CC)c(F)c1F |
| InChI | InChI=1S/C24H34F3N5O5S/c1-2-38(36,37)31-15(11-13-7-4-3-5-8-13)24(35)32-10-6-9-16(32)23(34)30-12-14-18(25)20(27)17(22(28)29)21(33)19(14)26/h13,15-16,31,33H,2-12H2,1H3,(H3,28,29)(H,30,34) |
| InChIKey | QNTJIPAXGLUKKB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 165.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|