C16H9F4N3O2 — CID 142007581
5-fluoro-2-phenoxy-4-[(2Z)-2-(3,3,3-trifluoro-2-oxopropylidene)hydrazinyl]benzonitrile (PubChem CID 142007581) has the molecular formula C16H9F4N3O2 and a molecular weight of 351.26 g/mol. Its IUPAC name is 5-fluoro-2-phenoxy-4-[(2Z)-2-(3,3,3-trifluoro-2-oxopropylidene)hydrazinyl]benzonitrile.
| Compound Name | 5-fluoro-2-phenoxy-4-[(2Z)-2-(3,3,3-trifluoro-2-oxopropylidene)hydrazinyl]benzonitrile |
|---|---|
| PubChem CID | 142007581 |
| Molecular Formula | C16H9F4N3O2 |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 5-fluoro-2-phenoxy-4-[(2Z)-2-(3,3,3-trifluoro-2-oxopropylidene)hydrazinyl]benzonitrile |
| SMILES | N#Cc1cc(F)c(N/N=C\C(=O)C(F)(F)F)cc1Oc1ccccc1 |
| InChI | InChI=1S/C16H9F4N3O2/c17-12-6-10(8-21)14(25-11-4-2-1-3-5-11)7-13(12)23-22-9-15(24)16(18,19)20/h1-7,9,23H/b22-9- |
| InChIKey | RIZLGZOWTGMHDO-AFPJDJCSSA-N |
| XLogP | 4.02 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|