C25H30O — CID 142007878
1-[(1Z,3E,4Z)-2-ethyl-3-ethylidene-1-phenylhexa-1,4-dienyl]-4-propoxybenzene (PubChem CID 142007878) has the molecular formula C25H30O and a molecular weight of 346.51 g/mol. Its IUPAC name is 1-[(1Z,3E,4Z)-2-ethyl-3-ethylidene-1-phenylhexa-1,4-dienyl]-4-propoxybenzene.
| Compound Name | 1-[(1Z,3E,4Z)-2-ethyl-3-ethylidene-1-phenylhexa-1,4-dienyl]-4-propoxybenzene |
|---|---|
| PubChem CID | 142007878 |
| Molecular Formula | C25H30O |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[(1Z,3E,4Z)-2-ethyl-3-ethylidene-1-phenylhexa-1,4-dienyl]-4-propoxybenzene |
| SMILES | C/C=C\C(=C/C)\C(CC)=C(\c1ccccc1)c1ccc(OCCC)cc1 |
| InChI | InChI=1S/C25H30O/c1-5-12-20(7-3)24(8-4)25(21-13-10-9-11-14-21)22-15-17-23(18-16-22)26-19-6-2/h5,7,9-18H,6,8,19H2,1-4H3/b12-5-,20-7+,25-24- |
| InChIKey | UYRAZDOTMGSDIK-QDBKTOKVSA-N |
| XLogP | 7.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|