C26H33NO — CID 142962747
2-[4-[(1Z,3E,4Z)-2-ethyl-3-ethylidene-1-phenylhexa-1,4-dienyl]phenoxy]-N,N-dimethylethanamine (PubChem CID 142962747) has the molecular formula C26H33NO and a molecular weight of 375.56 g/mol. Its IUPAC name is 2-[4-[(1Z,3E,4Z)-2-ethyl-3-ethylidene-1-phenylhexa-1,4-dienyl]phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-[(1Z,3E,4Z)-2-ethyl-3-ethylidene-1-phenylhexa-1,4-dienyl]phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 142962747 |
| Molecular Formula | C26H33NO |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 2-[4-[(1Z,3E,4Z)-2-ethyl-3-ethylidene-1-phenylhexa-1,4-dienyl]phenoxy]-N,N-dimethylethanamine |
| SMILES | C/C=C\C(=C/C)\C(CC)=C(\c1ccccc1)c1ccc(OCCN(C)C)cc1 |
| InChI | InChI=1S/C26H33NO/c1-6-12-21(7-2)25(8-3)26(22-13-10-9-11-14-22)23-15-17-24(18-16-23)28-20-19-27(4)5/h6-7,9-18H,8,19-20H2,1-5H3/b12-6-,21-7+,26-25- |
| InChIKey | IUVSHRGJAQUIQN-XOSDMDFDSA-N |
| XLogP | 6.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|