C26H22N4O3 — CID 142008326
4-(4-methoxy-3-phenylmethoxyphenyl)-2-(4-methylanilino)-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 142008326) has the molecular formula C26H22N4O3 and a molecular weight of 438.49 g/mol. Its IUPAC name is 4-(4-methoxy-3-phenylmethoxyphenyl)-2-(4-methylanilino)-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-methoxy-3-phenylmethoxyphenyl)-2-(4-methylanilino)-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 142008326 |
| Molecular Formula | C26H22N4O3 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 4-(4-methoxy-3-phenylmethoxyphenyl)-2-(4-methylanilino)-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | COc1ccc(-c2nc(Nc3ccc(C)cc3)[nH]c(=O)c2C#N)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H22N4O3/c1-17-8-11-20(12-9-17)28-26-29-24(21(15-27)25(31)30-26)19-10-13-22(32-2)23(14-19)33-16-18-6-4-3-5-7-18/h3-14H,16H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | UVEMNWNKFOOAKO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|