C19H18Cl2N4O — CID 142009030
1-(chloromethyl)-3-[[4-[5-(4-chlorophenyl)-1-methylpyrazol-3-yl]phenyl]methyl]urea (PubChem CID 142009030) has the molecular formula C19H18Cl2N4O and a molecular weight of 389.29 g/mol. Its IUPAC name is 1-(chloromethyl)-3-[[4-[5-(4-chlorophenyl)-1-methylpyrazol-3-yl]phenyl]methyl]urea.
| Compound Name | 1-(chloromethyl)-3-[[4-[5-(4-chlorophenyl)-1-methylpyrazol-3-yl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 142009030 |
| Molecular Formula | C19H18Cl2N4O |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 1-(chloromethyl)-3-[[4-[5-(4-chlorophenyl)-1-methylpyrazol-3-yl]phenyl]methyl]urea |
| SMILES | Cn1nc(-c2ccc(CNC(=O)NCCl)cc2)cc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18Cl2N4O/c1-25-18(15-6-8-16(21)9-7-15)10-17(24-25)14-4-2-13(3-5-14)11-22-19(26)23-12-20/h2-10H,11-12H2,1H3,(H2,22,23,26) |
| InChIKey | SLDMFVYRPPUJDE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|