About N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde
N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde (PubChem CID 142009439) has the molecular formula C12H20N2O2
and a molecular weight of 224.30 g/mol. Its IUPAC name is N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde.
Molecular Properties
| Compound Name | N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde |
| PubChem CID | 142009439 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde |
| SMILES | CNC1CCN(C)CC1.O=Cc1ccco1 |
| InChI | InChI=1S/C7H16N2.C5H4O2/c1-8-7-3-5-9(2)6-4-7;6-4-5-2-1-3-7-5/h7-8H,3-6H2,1-2H3;1-4H |
| InChIKey | KJYVHERAKAOEMZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde?
The IUPAC name of N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde (CID 142009439) is N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde.
What is the SMILES notation for N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde?
The canonical SMILES for N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde is CNC1CCN(C)CC1.O=Cc1ccco1.
What is the InChIKey of N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde?
The InChIKey is KJYVHERAKAOEMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.C5H4O2/c1-8-7-3-5-9(2)6-4-7;6-4-5-2-1-3-7-5/h7-8H,3-6H2,1-2H3;1-4H.
What are the key properties of N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde?
N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde has a molecular weight of 224.30 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-dimethylpiperidin-4-amine;furan-2-carbaldehyde is sourced from PubChem (CID 142009439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).