C13H23NS — CID 142009462
N,N-dimethyl-3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]sulfanylbutan-1-amine (PubChem CID 142009462) has the molecular formula C13H23NS and a molecular weight of 225.40 g/mol. Its IUPAC name is N,N-dimethyl-3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]sulfanylbutan-1-amine.
| Compound Name | N,N-dimethyl-3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]sulfanylbutan-1-amine |
|---|---|
| PubChem CID | 142009462 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | N,N-dimethyl-3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]sulfanylbutan-1-amine |
| SMILES | C=C(C)/C=C\C(=C)SC(C)CCN(C)C |
| InChI | InChI=1S/C13H23NS/c1-11(2)7-8-12(3)15-13(4)9-10-14(5)6/h7-8,13H,1,3,9-10H2,2,4-6H3/b8-7- |
| InChIKey | JGUZBXVVQIGFFJ-FPLPWBNLSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|