C11H23N — CID 142009655
prop-1-ene;1,4,4-trimethylpiperidine (PubChem CID 142009655) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is prop-1-ene;1,4,4-trimethylpiperidine.
| Compound Name | prop-1-ene;1,4,4-trimethylpiperidine |
|---|---|
| PubChem CID | 142009655 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | prop-1-ene;1,4,4-trimethylpiperidine |
| SMILES | C=CC.CN1CCC(C)(C)CC1 |
| InChI | InChI=1S/C8H17N.C3H6/c1-8(2)4-6-9(3)7-5-8;1-3-2/h4-7H2,1-3H3;3H,1H2,2H3 |
| InChIKey | FHSOHKFTETWWEV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|