C15H27N3O — CID 142010313
4-N-(3-morpholin-4-ylpentyl)cyclohexa-1,5-diene-1,4-diamine (PubChem CID 142010313) has the molecular formula C15H27N3O and a molecular weight of 265.40 g/mol. Its IUPAC name is 4-N-(3-morpholin-4-ylpentyl)cyclohexa-1,5-diene-1,4-diamine.
| Compound Name | 4-N-(3-morpholin-4-ylpentyl)cyclohexa-1,5-diene-1,4-diamine |
|---|---|
| PubChem CID | 142010313 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | 4-N-(3-morpholin-4-ylpentyl)cyclohexa-1,5-diene-1,4-diamine |
| SMILES | CCC(CCNC1C=CC(N)=CC1)N1CCOCC1 |
| InChI | InChI=1S/C15H27N3O/c1-2-15(18-9-11-19-12-10-18)7-8-17-14-5-3-13(16)4-6-14/h3-5,14-15,17H,2,6-12,16H2,1H3 |
| InChIKey | QMMYJGMUAAJACE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |