C17H23N3O4 — CID 142011415
N-[(2,3-dimethyl-6-nitrophenyl)methyl]-2-(2-oxoazepan-1-yl)acetamide (PubChem CID 142011415) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-[(2,3-dimethyl-6-nitrophenyl)methyl]-2-(2-oxoazepan-1-yl)acetamide.
| Compound Name | N-[(2,3-dimethyl-6-nitrophenyl)methyl]-2-(2-oxoazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 142011415 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-[(2,3-dimethyl-6-nitrophenyl)methyl]-2-(2-oxoazepan-1-yl)acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])c(CNC(=O)CN2CCCCCC2=O)c1C |
| InChI | InChI=1S/C17H23N3O4/c1-12-7-8-15(20(23)24)14(13(12)2)10-18-16(21)11-19-9-5-3-4-6-17(19)22/h7-8H,3-6,9-11H2,1-2H3,(H,18,21) |
| InChIKey | VFLFCKZGFDQMFG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|