C9H14O2S — CID 142012275
(3E)-3-ethylsulfonyl-2-methylhexa-1,3,5-triene (PubChem CID 142012275) has the molecular formula C9H14O2S and a molecular weight of 186.28 g/mol. Its IUPAC name is (3E)-3-ethylsulfonyl-2-methylhexa-1,3,5-triene.
| Compound Name | (3E)-3-ethylsulfonyl-2-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 142012275 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (3E)-3-ethylsulfonyl-2-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C(\C(=C)C)S(=O)(=O)CC |
| InChI | InChI=1S/C9H14O2S/c1-5-7-9(8(3)4)12(10,11)6-2/h5,7H,1,3,6H2,2,4H3/b9-7+ |
| InChIKey | CZEAWPNQJXXYHC-VQHVLOKHSA-N |
| XLogP | 2.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|