C9H13FO2S — CID 91585917
6-(ethylsulfonylmethyl)-2-fluorocyclohexa-1,3-diene (PubChem CID 91585917) has the molecular formula C9H13FO2S and a molecular weight of 204.27 g/mol. Its IUPAC name is 6-(ethylsulfonylmethyl)-2-fluorocyclohexa-1,3-diene.
| Compound Name | 6-(ethylsulfonylmethyl)-2-fluorocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 91585917 |
| Molecular Formula | C9H13FO2S |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 6-(ethylsulfonylmethyl)-2-fluorocyclohexa-1,3-diene |
| SMILES | CCS(=O)(=O)CC1C=C(F)C=CC1 |
| InChI | InChI=1S/C9H13FO2S/c1-2-13(11,12)7-8-4-3-5-9(10)6-8/h3,5-6,8H,2,4,7H2,1H3 |
| InChIKey | NYSZMZVGGYBWRP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |