C10H19F3OS — CID 142012406
(2R)-1-(7,7,7-trifluoroheptylsulfanyl)propan-2-ol (PubChem CID 142012406) has the molecular formula C10H19F3OS and a molecular weight of 244.32 g/mol. Its IUPAC name is (2R)-1-(7,7,7-trifluoroheptylsulfanyl)propan-2-ol.
| Compound Name | (2R)-1-(7,7,7-trifluoroheptylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 142012406 |
| Molecular Formula | C10H19F3OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2R)-1-(7,7,7-trifluoroheptylsulfanyl)propan-2-ol |
| SMILES | C[C@@H](O)CSCCCCCCC(F)(F)F |
| InChI | InChI=1S/C10H19F3OS/c1-9(14)8-15-7-5-3-2-4-6-10(11,12)13/h9,14H,2-8H2,1H3/t9-/m1/s1 |
| InChIKey | BWTLZDADNVWBCQ-SECBINFHSA-N |
| XLogP | 3.61 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|