C21H24Cl2N2O4S2 — CID 142013975
3-[4-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)butyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 142013975) has the molecular formula C21H24Cl2N2O4S2 and a molecular weight of 503.47 g/mol. Its IUPAC name is 3-[4-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)butyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 3-[4-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)butyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 142013975 |
| Molecular Formula | C21H24Cl2N2O4S2 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 3-[4-(2,5-dichloro-N-(4-methylphenyl)sulfonylanilino)butyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCCN2CSCC2C(=O)O)c2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O4S2/c1-15-4-7-17(8-5-15)31(28,29)25(19-12-16(22)6-9-18(19)23)11-3-2-10-24-14-30-13-20(24)21(26)27/h4-9,12,20H,2-3,10-11,13-14H2,1H3,(H,26,27) |
| InChIKey | XMXWLDLGYAZXQH-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|