About tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide
tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide (PubChem CID 142014754) has the molecular formula C32H72BrClNOP
and a molecular weight of 633.27 g/mol. Its IUPAC name is tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide.
Molecular Properties
| Compound Name | tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide |
| PubChem CID | 142014754 |
| Molecular Formula | C32H72BrClNOP |
| Molecular Weight | 633.27 g/mol |
| Exact Mass | 631.42 |
| IUPAC Name | tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide |
| SMILES | CCCCP(Cl)(CCCC)(CCCC)CCCOC.CCCC[N+](CCCC)(CCCC)CCCC.[Br-] |
| InChI | InChI=1S/C16H36ClOP.C16H36N.BrH/c1-5-8-13-19(17,14-9-6-2,15-10-7-3)16-11-12-18-4;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;5-16H2,1-4H3;1H/q;+1;/p-1 |
| InChIKey | MPBBLLBLBZLPLJ-UHFFFAOYSA-M |
| XLogP | 8.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 633.27 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide?
The IUPAC name of tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide (CID 142014754) is tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide.
What is the SMILES notation for tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide?
The canonical SMILES for tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide is CCCCP(Cl)(CCCC)(CCCC)CCCOC.CCCC[N+](CCCC)(CCCC)CCCC.[Br-].
What is the InChIKey of tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide?
The InChIKey is MPBBLLBLBZLPLJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36ClOP.C16H36N.BrH/c1-5-8-13-19(17,14-9-6-2,15-10-7-3)16-11-12-18-4;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;5-16H2,1-4H3;1H/q;+1;/p-1.
What are the key properties of tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide?
tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide has a molecular weight of 633.27 g/mol, XLogP of 8.14, 25 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;tributyl-chloro-(3-methoxypropyl)-λ5-phosphane;bromide is sourced from PubChem (CID 142014754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).