About dichloromethane;tetrabutylazanium;bromide
dichloromethane;tetrabutylazanium;bromide (PubChem CID 159516193) has the molecular formula C17H38BrCl2N
and a molecular weight of 407.31 g/mol. Its IUPAC name is dichloromethane;tetrabutylazanium;bromide.
Molecular Properties
| Compound Name | dichloromethane;tetrabutylazanium;bromide |
| PubChem CID | 159516193 |
| Molecular Formula | C17H38BrCl2N |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | dichloromethane;tetrabutylazanium;bromide |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.ClCCl.[Br-] |
| InChI | InChI=1S/C16H36N.CH2Cl2.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1-3;/h5-16H2,1-4H3;1H2;1H/q+1;;/p-1 |
| InChIKey | MBFMVPAHIMFBPL-UHFFFAOYSA-M |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;tetrabutylazanium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;tetrabutylazanium;bromide?
The IUPAC name of dichloromethane;tetrabutylazanium;bromide (CID 159516193) is dichloromethane;tetrabutylazanium;bromide.
What is the SMILES notation for dichloromethane;tetrabutylazanium;bromide?
The canonical SMILES for dichloromethane;tetrabutylazanium;bromide is CCCC[N+](CCCC)(CCCC)CCCC.ClCCl.[Br-].
What is the InChIKey of dichloromethane;tetrabutylazanium;bromide?
The InChIKey is MBFMVPAHIMFBPL-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.CH2Cl2.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1-3;/h5-16H2,1-4H3;1H2;1H/q+1;;/p-1.
What are the key properties of dichloromethane;tetrabutylazanium;bromide?
dichloromethane;tetrabutylazanium;bromide has a molecular weight of 407.31 g/mol, XLogP of 3.43, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;tetrabutylazanium;bromide is sourced from PubChem (CID 159516193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).