About bis(tetrabutylazanium);tetrachloroplatinum(2-)
bis(tetrabutylazanium);tetrachloroplatinum(2-) (PubChem CID 87982663) has the molecular formula C32H72Cl4N2Pt
and a molecular weight of 821.83 g/mol. Its IUPAC name is bis(tetrabutylazanium);tetrachloroplatinum(2-).
Molecular Properties
| Compound Name | bis(tetrabutylazanium);tetrachloroplatinum(2-) |
| PubChem CID | 87982663 |
| Molecular Formula | C32H72Cl4N2Pt |
| Molecular Weight | 821.83 g/mol |
| Exact Mass | 819.41 |
| IUPAC Name | bis(tetrabutylazanium);tetrachloroplatinum(2-) |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.Cl[Pt-2](Cl)(Cl)Cl |
| InChI | InChI=1S/2C16H36N.4ClH.Pt/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;;;;/h2*5-16H2,1-4H3;4*1H;/q2*+1;;;;;+2/p-4 |
| InChIKey | MADCKMHNJKUVIH-UHFFFAOYSA-J |
| XLogP | 12.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 821.83 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze bis(tetrabutylazanium);tetrachloroplatinum(2-) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tetrabutylazanium);tetrachloroplatinum(2-)?
The IUPAC name of bis(tetrabutylazanium);tetrachloroplatinum(2-) (CID 87982663) is bis(tetrabutylazanium);tetrachloroplatinum(2-).
What is the SMILES notation for bis(tetrabutylazanium);tetrachloroplatinum(2-)?
The canonical SMILES for bis(tetrabutylazanium);tetrachloroplatinum(2-) is CCCC[N+](CCCC)(CCCC)CCCC.CCCC[N+](CCCC)(CCCC)CCCC.Cl[Pt-2](Cl)(Cl)Cl.
What is the InChIKey of bis(tetrabutylazanium);tetrachloroplatinum(2-)?
The InChIKey is MADCKMHNJKUVIH-UHFFFAOYSA-J. The full InChI is InChI=1S/2C16H36N.4ClH.Pt/c2*1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;;;;/h2*5-16H2,1-4H3;4*1H;/q2*+1;;;;;+2/p-4.
What are the key properties of bis(tetrabutylazanium);tetrachloroplatinum(2-)?
bis(tetrabutylazanium);tetrachloroplatinum(2-) has a molecular weight of 821.83 g/mol, XLogP of 12.76, 24 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tetrabutylazanium);tetrachloroplatinum(2-) is sourced from PubChem (CID 87982663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).